(Z)-3-Hexen-1-yl b-D-glucopyranoside
(Z)-3-Hexen-1-yl b-D-glucopyranoside, a naturally occurring glycoside compound derived from plants, displays potent anti-inflammatory and anti-oxidant properties. This unique compound is highly sought-after for its therapeutic potential, especially in neurodegenerative diseases such as Alzheimer’s and Parkinson’s. Notably, scientific research has confirmed the powerful neuroprotective effects of (Z)-3-Hexen-1-yl b-D-glucopyranoside, highlighting its tremendous potential in the realm of medical research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 95632-87-4 |
| Pricing | Inquire |
| Cas | 95632-87-4 |
| Molecular Weight | 262.30 |
| Molecular Formula | C12H22O6 |
| Canonical SMILES | CCC=CCCOC1C(C(C(C(O1)CO)O)O)O |