4-Chloro-7-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine
4-Chloro-7-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-7H-pyrrolo[2.3-d]pyrimidine, known for its potent antiviral properties, is mainly used to study a wide array of viral infections such as HIV and hepatitis B. By impeding viral DNA replication, it effectively curtails the viral burden within the host organism.
| Supplier | BOC Sciences |
|---|---|
| Product # | 169516-60-3 |
| Pricing | Inquire |
| Cas | 169516-60-3 |
| Molecular Weight | 287.68 |
| Molecular Formula | C11H11ClFN3O3 |
| Canonical SMILES | C1=CN(C2=C1C(=NC=N2)Cl)C3C(C(C(O3)CO)O)F |