2'-Deoxy-5-fluorocytidine 5'-monophosphate
2'-Deoxy-5-fluorocytidine 5'-monophosphate, a pivotal compound within the biomedical sector, assumes a critical role in the management of diverse ailments. By impeding RNA virus replication, particularly those associated with influenza, hepatitis C, and HIV, this product exerts its therapeutic effect. Moreover, it serves as a precursor for antiviral nucleoside analog synthesis, rendering it an invaluable asset in the realm of pharmaceutical research against viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 847-22-3 |
| Pricing | Inquire |
| Cas | 847-22-3 |
| Molecular Weight | 325.19 |
| Molecular Formula | C9H13FN3O7P |
| Canonical SMILES | C1C(C(OC1N2C=C(C(=NC2=O)N)F)COP(=O)(O)O)O |