Raloxifene Bismethyl Ether-[d4]
Raloxifene Bismethyl Ether-[d4] is a labelled analogue of r Raloxifene Bismethyl Ether. Raloxifene Bismethyl Ether is a synthetic intermediate of raloxifene, which is a non-steroidal estrogen receptor mixed agonist/antagonist.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-012104 |
| Pricing | Inquire |
| Cas | 1185006-58-9 |
| Molecular Weight | 505.66 |
| Molecular Formula | C30H27D4NO4S |
| Canonical SMILES | COC1=CC=C(C=C1)C2=C(C3=C(S2)C=C(C=C3)OC)C(=O)C4=CC=C(C=C4)OCCN5CCCCC5 |