AT7519 HCl
AT-7519 is an orally bioavailable small molecule CDK inhibitor with potential antineoplastic activity. AT7519M selectively binds to and inhibits cyclin dependent kinases (CDKs), which may result in cell cycle arrest, induction of apoptosis, and inhibition of tumor cell proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-100271 |
| Pricing | Inquire |
| Cas | 902135-91-5 |
| Molecular Weight | 418.71 |
| Molecular Formula | C16H18Cl3N5O2 |
| Canonical SMILES | C1CNCCC1NC(=O)C2=C(C=NN2)NC(=O)C3=C(C=CC=C3Cl)Cl.Cl |