3-Methoxy Loratadine-[d4]
3-Methoxy Loratadine-[d4] is the labelled analogue of 3-Methoxy Loratadine, which is useful as an inhibitor of both farnesyl protein transferase and geranylgeranyl protein transferase in the treatment of cell-proliferative diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002768 |
| Pricing | Inquire |
| Cas | 1189501-87-8 |
| Molecular Weight | 416.93 |
| Molecular Formula | C23H21D4ClN2O3 |
| Canonical SMILES | CCOC(=O)N1CCC(=C2C3=C(CCC4=C2N=CC(=C4)OC)C=C(C=C3)Cl)CC1 |