2-Amino-6-chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purine
2-Amino-6-chloro-9-(2-C-methyl-β-D-ribofuranosyl)-9H-purine possesses unique chemical properties that are invaluable in studying nucleic acid metabolism and viral pathogenesis. Additionally, this important pharmaceutical intermediate stands out as a potent inhibitor of viral DNA and RNA replication and hits the mark in blocking the synthesis of cancer cells. Its multifaceted applications extend to the treatment of viral infections, including hepatitis B and C, and oncology.
| Supplier | BOC Sciences |
|---|---|
| Product # | 640725-74-2 |
| Pricing | Inquire |
| Cas | 640725-74-2 |
| Molecular Weight | 315.71 |
| Molecular Formula | C11H14ClN5O4 |
| Canonical SMILES | CC1(C(C(OC1N2C=NC3=C2N=C(N=C3Cl)N)CO)O)O |