5'-Deoxy-5'-N,N-dimethylaminothymidine
5'-Deoxy-5'-N,N-dimethylaminothymidine is an exceptionally powerful antiviral compound, finding its application in the research of a broad spectrum of viral ailments, encompassing influenza, herpes and hepatitis. Acting as a nucleoside analogue, this compound skillfully disrupts the enhancement of viral DNA, unequivocally restraining viral replication and alleviating the intensity of viral infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 162466-79-7 |
| Pricing | Inquire |
| Cas | 162466-79-7 |
| Molecular Weight | 269.30 |
| Molecular Formula | C12H19N3O4 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)CN(C)C)O |