Tert-butyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate
Tert-butyl 7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene-9-carboxylate is a biomedical product used for the drug development of certain diseases. It exhibits potential in targeting specific protein receptors implicated in various drug-resistant cancers, making it a promising candidate for anticancer therapies.
| Supplier | BOC Sciences |
|---|---|
| Product # | BADC-01584 |
| Pricing | Inquire |
| Cas | 1313034-29-5 |
| Molecular Weight | 351.25 |
| Molecular Formula | C18H30BNO5 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3COCC(C2)N3C(=O)OC(C)(C)C |