Ramelteon Impurity 1 HCl
Ramelteon Impurity 1 HCl is an impurity of Ramelteon. Ramelteon is a potent and selective agonist at melatonin MT1/MT2 receptor. Ramelteon is a sleep agent medication used to treat sleeplessness (insomnia).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1252018-54-4 |
| Pricing | Inquire |
| Cas | 1252018-54-4 |
| Molecular Weight | 237.72 |
| Molecular Formula | C13H15NO.HCl |
| Canonical SMILES | C1CC2=C(C1CCN)C3=C(C=C2)OC=C3.Cl |