Novobiocin sodium
Novobiocin Sodium is a very potent bacterial DNA gyrase and human organic anion transporter with Ki of 14.87 ± 0.40 μM for hOAT1, 4.77 ± 1.12 μM for hOAT3 and 90.50 ± 7.50 μM for hOAT4.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-03760 |
| Pricing | Inquire |
| Cas | 1476-53-5 |
| Molecular Weight | 634.60 |
| Molecular Formula | C31H35N2NaO11 |
| Canonical SMILES | CC1=C(C=CC2=C1OC(=O)C(=C2O)NC(=O)C3=CC(=C(C=C3)[O-])CC=C(C)C)OC4C(C(C(C(O4)(C)C)OC)OC(=O)N)O.[Na+] |