Carbinoxamine Impurity A
α-(4-Chlorophenyl)-2-pyridinemethanol is used as a reagent in the synthesis of Carbinoxamine), a histamine H1 antagonist. α-(4-Chlorophenyl)-2-pyridinemethanol is also an intermediate in the synthesis of Bepotastine besylate, a non-sedating H1-antagonist that has anti-inflammatory activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 27652-89-7 |
| Pricing | Inquire |
| Cas | 27652-89-7 |
| Molecular Weight | 219.67 |
| Molecular Formula | C12H10ClNO |
| Canonical SMILES | C1=CC=NC(=C1)C(C2=CC=C(C=C2)Cl)O |