N,N-Dimethyl-L-Tyrosine
N,N-Dimethyl-L-Tyrosine, a derivative of the amino acid tyrosine, has been a subject of interest in the research field due to its key role in elucidating amino acid metabolism. Additionally, it has been extensively studied for its precursor role in the synthesis of well-known neurotransmitters like dopamine and norepinephrine, thereby finding novel therapeutic applications in the treatment of neurodegenerative disorders such as Parkinson's disease and depression. The significance of this chemical compound could not be overstated in the realm of medicinal research.
| Supplier | BOC Sciences |
|---|---|
| Product # | B2699-052153 |
| Pricing | Inquire |
| Cas | 17350-74-2 |
| Molecular Weight | 209.24 |
| Molecular Formula | C11H15NO3 |
| Canonical SMILES | CN(C)C(CC1=CC=C(C=C1)O)C(=O)O |