Lopixibat chloride
Lopixibat, also called as LUM-001 and Maralixibat, is an inhibitor of the sodium bile acid cotransporter and a selective Ileal bile acid transporter inhibitor. Lopixibat is in development for the treatment of cholestatic liver disorders in paediatric and adult patients.
| Supplier | BOC Sciences |
|---|---|
| Product # | 228113-66-4 |
| Pricing | Inquire |
| Cas | 228113-66-4 |
| Molecular Weight | 710.41 |
| Molecular Formula | C40H56ClN3O4S |
| Canonical SMILES | CCCCC1(CS(=O)(=O)C2=C(C=C(C=C2)N(C)C)C(C1O)C3=CC=C(C=C3)OCC4=CC=C(C=C4)C[N+]56CCN(CC5)CC6)CCCC.[Cl-] |