O-Demethyl Vandetanib-[d4]
O-Demethyl Vandetanib-[d4], is the labelled analogue of O-Demethyl Vandetanib, which is a metabolite of Vandetanib. Vandetanib is an anti-cancer medication that is used for the treatment of certain tumours of the thyroid gland.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-003629 |
| Pricing | Inquire |
| Cas | 1346599-97-0 |
| Molecular Weight | 465.35 |
| Molecular Formula | C21H18D4BrFN4O2 |
| Canonical SMILES | CN1CCC(CC1)COC2=C(C=C3C(=C2)N=CN=C3NC4=C(C=C(C=C4)Br)F)O |