2,2,2-Trichloroacetimidic Acid 2-Phenylpropan-2-yl Ester, Technical Grade
2,2,2-Trichloroacetimidic Acid 2-Phenylpropan-2-yl Ester, can be used in the synthesis of various pharmaceutical compounds. It can be used in the preparation of cyclic peptides and lactam-bridged dipeptides.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB075673 |
| Pricing | Inquire |
| Cas | 147221-33-8 |
| Molecular Weight | 280.58 |
| Molecular Formula | C11H12Cl3NO |
| Canonical SMILES | CC(C)(C1=CC=CC=C1)OC(=N)C(Cl)(Cl)Cl |