Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside
Propyl 2-acetamido-2-deoxy-b-D-glucopyranoside is a paramount compound extensively employed in the biomedical sector serving as a catalyst for drug development and research, focusing on ailments of multiple afflictions, encompassing bacterial infections, inflammation and autoimmune disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70832-36-9 |
| Pricing | Inquire |
| Cas | 70832-36-9 |
| Molecular Weight | 263.29 |
| Molecular Formula | C11H21NO6 |
| Canonical SMILES | CCCOC1C(C(C(C(O1)CO)O)O)NC(=O)C |