Ibuprofen Carboxylic Acid-[d3] (Mixture of Diastereomers)
Ibuprofen Carboxylic Acid-[d3] (Mixture of Diastereomers) is the labelled derivative of Ibuprofen Carboxylic Acid, the major labelled metabolite of Ibuprofen which may reduce the risk of cataract by protecting lenticular enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005873 |
| Pricing | Inquire |
| Cas | 1216505-29-1 |
| Molecular Weight | 239.28 |
| Molecular Formula | C13H13D3O4 |
| Canonical SMILES | CC(CC1=CC=C(C=C1)C(C)C(=O)O)C(=O)O |