Clecarmycin C
It is produced by the strain of Streptomyces sp. DO-114. Clecarmycin C has anti-gram-positive bacteria activity with MIC 0.04-0.33μg/mL. It also showed strong cytotoxicity, with IC50 of 11.5 mg/mL against HeLa S3 cells, which was 10-20 times stronger than adriamycin.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00369 |
| Pricing | Inquire |
| Cas | 136427-31-1 |
| Molecular Weight | 550.51 |
| Molecular Formula | C29H26O11 |
| Canonical SMILES | CC1C(C(=O)CC(O1)C23C(C4=C(C=C5C(=C4O)C=C(C6=C5OC(=CC6=O)C7(C(O7)C8CO8)C)C)C(=O)C2O3)O)O |