2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-methyluridine
2',3',5'-Tri-O-benzoyl-2'-C-methyl-5-methyluridine is a valuable compound in the biomedical industry. It finds applications in the development of antiviral drugs targeting diseases caused by RNA viruses, like hepatitis C and influenza. This compound's unique chemical structure contributes to its potential therapeutic properties, making it a promising candidate for drug discovery and research in the field of biomedicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 957535-53-4 |
| Pricing | Inquire |
| Cas | 957535-53-4 |
| Molecular Weight | 584.57 |
| Molecular Formula | C32H28N2O9 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2C(C(C(O2)COC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4)(C)OC(=O)C5=CC=CC=C5 |