M 24
M 24 is the first selective AT2 receptor agonist (Ki 0.4nM and 10.000 nM for AT2 and AT1 respectively). M 24 effects against endothelial inflammation and leukocyte adhesion both in vitro and in vivo.
| Supplier | BOC Sciences |
|---|---|
| Product # | 477775-14-7 |
| Pricing | Inquire |
| Cas | 477775-14-7 |
| Molecular Weight | 475.62 |
| Molecular Formula | C23H29N3O4S2 |
| Canonical SMILES | CCCCOC(=O)NS(=O)(=O)C1=C(C=C(S1)CC(C)C)C2=CC=C(C=C2)CN3C=CN=C3 |