N-[5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]acetamide
N-[5-(tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-yl]acetamide is a remarkable biomedical versatile compound that holds significant promise in combating select diseases. Demonstrating its power as an impressive inhibitor, it effectively thwarts the progression of these ailments by specifically targeting and neutralizing crucial enzymes.
| Supplier | BOC Sciences |
|---|---|
| Product # | 904326-87-0 |
| Pricing | Inquire |
| Cas | 904326-87-0 |
| Molecular Weight | 262.113 |
| Molecular Formula | C13H19BN2O3 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(C=C2)NC(=O)C |