Edrophonium chloride
Edrophonium chloride is a reversible Acetylcholinesterase inhibitor which is effective in avoiding the decomposition of the neurotransmitter acetylcholine competitively so that could be commonly used in the diagnosis of myasthenia gravis and other sorts o
| Supplier | BOC Sciences |
|---|---|
| Product # | 116-38-1 |
| Pricing | Inquire |
| Cas | 116-38-1 |
| Molecular Weight | 201.69 |
| Molecular Formula | C10H16NOCl |
| Canonical SMILES | CC[N+](C)(C)C1=CC(=CC=C1)O.[Cl-] |