Naphthol AS-E acetate
Naphthol AS-E acetate, a widely recognized chemical compound within the biomedical industry, proves indispensable in the synthesis of diagnostic reagents, playing a pivotal role in disease detection. Concurrently, it serves a critical function in the creation of pharmaceutical drugs, specifically those harnessed to combat malignant neoplasms, communicable ailments, and immunological dysfunctions.
| Supplier | BOC Sciences |
|---|---|
| Product # | 84100-15-2 |
| Pricing | Inquire |
| Cas | 84100-15-2 |
| Molecular Weight | 339.8 |
| Molecular Formula | C19H14ClNO3 |
| Canonical SMILES | CC(=O)OC1=CC2=CC=CC=C2C=C1C(=O)NC3=CC=C(C=C3)Cl |