Chloropyramine Impurity 1 HCl
Tripelennamine hydrochloride, the hydrochloride salt form of tripelennamine, is a blood-brain barrier penetrant and orally active H1 receptor antagonist. Tripelennamine, also known as Pyribenzamine, exhibits antipruritic and first-generation antihistamine properties.
| Supplier | BOC Sciences |
|---|---|
| Product # | B0084-363287 |
| Pricing | Inquire |
| Cas | 154-69-8 |
| Molecular Weight | 291.82 |
| Molecular Formula | C16H22ClN3 |
| Canonical SMILES | CN(C)CCN(CC1=CC=CC=C1)C2=CC=CC=N2.Cl |