17-Phenyl trinor prostaglandin E2 ethyl amide
17-Phenyl trinor PGE2 ethyl amide is derived from 17-phenyl trinor PGE2, a synthetic analog of PGE2 that acts as an agonist of EP1 and EP3 receptors in mice (Ki = 14 and 3.7 nM, respectively) and EP1, EP3, and EP4 in rats (Ki = 25, 4.3, and 54 nM, respectively).
| Supplier | BOC Sciences |
|---|---|
| Product # | 1219032-20-8 |
| Pricing | Inquire |
| Cas | 1219032-20-8 |
| Molecular Weight | 413.6 |
| Molecular Formula | C25H35NO4 |
| Canonical SMILES | CCNC(=O)CCCC=CCC1C(C(CC1=O)O)C=CC(CCC2=CC=CC=C2)O |