N4-Benzoyl-2'-deoxy-5'-O-DMT-2'-fluoro-5-methylcytidine
N4-Benzoyl-2'-deoxy-5'-O-DMT-2'-fluoro-5-methylcytidine, a compound highly regarded in the biomedical industry, showcases exceptional potential as a robust antiviral agent, with a focused application on combatting viral infections. Through its ability to impede viral replication and thwart the dissemination of viruses within the body, this compound represents a significant advancement in the treatment of specific diseases caused by viral infections. With its precise mode of action and remarkable therapeutic prospects, it emerges as a pivotal instrument for the development of groundbreaking antiviral medications within the domain of biomedicine.
| Supplier | BOC Sciences |
|---|---|
| Product # | 182495-82-5 |
| Pricing | Inquire |
| Cas | 182495-82-5 |
| Molecular Weight | 665.72 |
| Molecular Formula | C38H36FN3O7 |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C2=CC=CC=C2)C3C(C(C(O3)COC(C4=CC=CC=C4)(C5=CC=C(C=C5)OC)C6=CC=C(C=C6)OC)O)F |