rac-Matairesinol-[d6]
rac-Matairesinol-[d6] is the labelled analogue of rac-Matairesinol, which is a plant lignan found in oil seeds, whole grains, vegetables and fruits. It is a precursor to enterolignans that have potential anticancer properties and may reduce the risk of cardiovascular diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-013736 |
| Pricing | Inquire |
| Cas | 1346600-02-9 |
| Molecular Weight | 364.42 |
| Molecular Formula | C20H16D6O6 |
| Canonical SMILES | COC1=C(C=CC(=C1)CC2COC(=O)C2CC3=CC(=C(C=C3)O)OC)O |