N-Ethyltoluenesulfonamide (o and p mixture)
N-Ethyltoluenesulfonamide (o and p mixture) is a highly versatile biomedical compound with exceptional chemical properties. It holds great promise in the realm of drug development and research. Its multifaceted applications encompass pharmaceutical and agrochemical synthesis, offering a wealth of opportunities for scientific advancements. Serving as a critical component, it diligently contributes to the treatment of numerous diseases that afflict humanity, such as cancer, diabetes, and cardiovascular disorders.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76902-32-4 |
| Pricing | Inquire |
| Cas | 76902-32-4 |
| Molecular Weight | 199.27 |
| Molecular Formula | C9H13NO2S |
| Canonical SMILES | CCNS(=O)(=O)C1=CC=C(C=C1)C.CCNS(=O)(=O)C1=CC=CC=C1C |