Sodium glycodeoxycholate
Sodium deoxyglycolic acid is a kind of bile salt, and exists in bile in the form of combining with glycine or taurine to form glycodeoxycholic acid or sodium taurodeoxycholate. It is cholanoic acid that forms many organic compounds and stable molecular compounds.
| Supplier | BOC Sciences |
|---|---|
| Product # | NP6242 |
| Pricing | Inquire |
| Cas | 16409-34-0 |
| Molecular Weight | 471.61 |
| Molecular Formula | C26H42NNaO5 |
| Canonical SMILES | CC(CCC(=O)NCC(=O)O)C1CCC2C1(C(CC3C2CCC4C3(CCC(C4)O)C)O)C |