Methyl 3-[3-(Benzyloxy)phenyl]-3-oxopropionate
Methyl 3-[3-(Benzyloxy)phenyl]-3-oxopropionate (CAS# 150356-53-9) is an intermediate in the synthesis of β-(m-Hydroxyphenyl)hydracrylic Acid (H949280). β-(m-Hydroxyphenyl)hydracrylic Acid is a urinary metabolite of phenylalanine from the Clostridium gram-positive bacteria cell line. Urinary metabolite of Rutin (R701800), a capillary protectant in plants.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB010525 |
| Pricing | Inquire |
| Cas | 150356-53-9 |
| Molecular Weight | 284.31 |
| Molecular Formula | C17H16O4 |
| Canonical SMILES | COC(=O)CC(=O)C1=CC(=CC=C1)OCC2=CC=CC=C2 |