6-O-Trityl-D-mannose
6-O-Trityl-D-mannose, a pivotal compound within the realm of the biomedical industry, garners extensive employment in the progress of pharmaceuticals and therapeutics catered towards an array of maladies. Its vast potential resides in the amelioration of cancer, diabetes, and viral infections alike. Notably, this compound assumes a substantial function by augmenting drug efficacy and facilitating precision-guided drug transportation mechanisms.
| Supplier | BOC Sciences |
|---|---|
| Product # | 160712-27-6 |
| Pricing | Inquire |
| Cas | 160712-27-6 |
| Molecular Weight | 422.47 |
| Molecular Formula | C25H26O6 |
| Canonical SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)OCC4C(C(C(C(O4)O)O)O)O |