O-Acetylsalicyloyl chloride
O-Acetylsalicyloyl chloride (CAS# 5538-51-2) is used in the derivatisation of amines, and also improve electrochemical detection of these amines when they are run through high-performance liquid chromatography. O-Acetylsalicyloyl chloride is also used as a reagent to synthesize benzimidazole derivatives, compounds that inhibit leukotriene synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 5538-51-2 |
| Pricing | Inquire |
| Cas | 5538-51-2 |
| Molecular Weight | 198.60 |
| Molecular Formula | C9H7ClO3 |
| Canonical SMILES | CC(=O)OC1=CC=CC=C1C(=O)Cl |