3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-5-trifluoromethyl-arabinouridine
3',5'-Di-O-benzoyl-2'-deoxy-2'-fluoro-5-trifluoromethyl-arabinouridine, an extraordinary antiviral compound, exhibits remarkable efficacy in combating RNA viral infections. Diseases like influenza, hepatitis C, and respiratory syncytial virus (RSV) can be effectively treated with this potent product due to its distinctive chemical structure.
| Supplier | BOC Sciences |
|---|---|
| Product # | 117311-99-6 |
| Pricing | Inquire |
| Cas | 117311-99-6 |
| Molecular Weight | 522.40 |
| Molecular Formula | C24H18F4N2O7 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)OCC2C(C(C(O2)N3C=C(C(=O)NC3=O)C(F)(F)F)F)OC(=O)C4=CC=CC=C4 |