Oxacillin Sodium Salt
The sodium salt form of Oxacillin which is a narrow-spectrum antibiotic and commonly used for studying the mechanisms of penicillinase resistance. It can be used for penicillin-resistant Staphylococcus infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1173-88-2 |
| Pricing | Inquire |
| Cas | 1173-88-2 |
| Molecular Weight | 423.42 |
| Molecular Formula | C19H18N3NaO5S |
| Canonical SMILES | CC1=C(C(=NO1)C2=CC=CC=C2)C(=O)NC3C4N(C3=O)C(C(S4)(C)C)C(=O)[O-].[Na+] |