Cyclosporine EP Impurity B
Cyclosporine EP Impurity B is a closely related co-metabolite of cyclosporin A. It has no immunosuppressive activity and has been used as a control to determine the role of immunosuppression in cyclosporin A pharmacology, especially in the treatment of parasitic infections.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-05757 |
| Pricing | Inquire |
| Cas | 59865-15-5 |
| Molecular Weight | 1204.62 |
| Molecular Formula | C62H113N11O12 |
| Canonical SMILES | CCCCC(C)C(C1C(=O)NC(C(=O)N(CC(=O)N(C(C(=O)NC(C(=O)N(C(C(=O)NC(C(=O)NC(C(=O)N(C(C(=O)N(C(C(=O)N(C(C(=O)N1C)C(C)C)C)CC(C)C)C)CC(C)C)C)C)C)CC(C)C)C)C(C)C)CC(C)C)C)C)CC)O |