N4-Acetyl-5-methylcytidine
N4-Acetyl-5-methylcytidine is a promising compound utilized in biomedicine. With its potential anti-viral properties, this product exhibits efficacy against viral diseases such as Hepatitis B and Influenza. Its bioactivity is attributed to its ability to inhibit viral replication and promote immune response.
| Supplier | BOC Sciences |
|---|---|
| Product # | 31077-96-0 |
| Pricing | Inquire |
| Cas | 31077-96-0 |
| Molecular Weight | 299.28 |
| Molecular Formula | C12H17N3O6 |
| Canonical SMILES | CC1=CN(C(=O)N=C1NC(=O)C)C2C(C(C(O2)CO)O)O |