Hemin
Hemin, a chemical compound derived from heme, plays a crucial role in the management of acute intermittent porphyria. The intravenous administration of this medication is essential for mitigating the diverse array of symptoms linked to this genetic disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 16009-13-5 |
| Pricing | Inquire |
| Cas | 16009-13-5 |
| Molecular Weight | 651.95 |
| Molecular Formula | C34H32ClFeN4O4 |
| Canonical SMILES | [H+].O=C([O-])CCC=1C2=CC3=C(C(=C4C=C5C(C=C)=C(C=6C=C7C(C=C)=C(C8=CC(C1C)=[N]2[Fe+3]([Cl-])([N]56)([N-]78)[N-]43)C)C)C)CCC(=O)[O-] |