4'-C-Azido-3'-deoxy-3'-fluorouridine
4'-C-Azido-3'-deoxy-3'-fluorouridine, a remarkable compound, stands as an efficacious antiviral agent within the realms of biomedical research. Its main purpose finds resonance in meticulously probing the intricate process of RNA virus replication, unraveling mysteries surrounding viruses such as HIV and hepatitis C. Diving deeper into its mechanism, this prodigious product showcases formidable antiviral prowess by exerting a potent inhibition on viral RNA synthesis, thereby inducing a formidable deterrent against the rampant proliferation of viral particles.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1365258-17-8 |
| Pricing | Inquire |
| Cas | 1365258-17-8 |
| Molecular Weight | 287.20 |
| Molecular Formula | C9H10FN5O5 |
| Canonical SMILES | C1=CN(C(=O)NC1=O)C2C(C(C(O2)(CO)N=[N+]=[N-])F)O |