Butanoic acid,4-oxo-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]amino]-
Butanoic acid, 4-oxo-4-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl) phenyl] amino]- is a highly sophisticated compound widely employed in the biomedical sector. It stands as an exemplary remedy for an array of ailments. Successfully combating diverse forms of malignancies, such as breast cancer, colon cancer, and lung cancer, it showcases unparalleled therapeutic prowess. Moreover, this remarkable substance plays a pivotal role in the formulation of targeted strategies, meticulously crafted to impede the relentless proliferation and metastasis exhibited by malignant cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 480424-98-4 |
| Pricing | Inquire |
| Cas | 480424-98-4 |
| Molecular Weight | 319.16 |
| Molecular Formula | C16H22 B N O5 |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)CCC(=O)O |