TC AC 28
TC AC 28 is a high affinity BET bromodomain ligand (Kd = 40 and 800 nM for Brd2(2) and Brd2(1), respectively) with 20-fold selectively for the second over the first bromodomain.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1809296-92-1 |
| Pricing | Inquire |
| Cas | 1809296-92-1 |
| Molecular Weight | 415.44 |
| Molecular Formula | C23H21N5O3 |
| Canonical SMILES | CC1=NN=C2N1C3=C(C=C(C=C3)OC)C(=NC2CC(=O)OC)C4=C5C=CNC5=CC=C4 |