Metanephrine-[13C,d3]
Metanephrine-[13C,d3] is the labelled analogue of Metanephrine, which is a metabolite of Epinephrine. Epinephrine is an endogenous catcholamine with combined α-and β-agonist activity and its principal sympathomimetic hormone is produced by the adrenal medulla.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004692 |
| Pricing | Inquire |
| Molecular Weight | 201.24 |
| Molecular Formula | C9[13C]H12D3NO3 |
| Canonical SMILES | CNCC(C1=CC(=C(C=C1)O)OC)O |