Progesterone EP Impurity L
Progesterone EP Impurity L is an impurity of Progesterone, which is an endogenous steroid and progestogen sex hormone involved in the menstrual cycle, pregnancy, and embryogenesis of humans and other species.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2257421-80-8 |
| Pricing | Inquire |
| Cas | 2257421-80-8 |
| Molecular Weight | 326.47 |
| Molecular Formula | C22H30O2 |
| Canonical SMILES | CC12CCC3C(C1CCC2C(=C)C=O)CCC4=CC(=O)CCC34C |