1-O-Acetyl-2,3,5-tri-O-benzoyl-L-ribose
1-O-Acetyl-2,3,5-tri-O-benzoyl-L-ribose is an intermediate in the synthesis of L-Adenosine (A291823), an intermediate in the synthesis of (2S,3S,4R,5R)-2-(6-Amino-9H-purin-9-yl)-5-(((3-aminophenyl)thio)methyl)tetrahydrofuran-3,4-diol (A609900), an enantiomer of (2R,3R,4S,5S)-2-(6-Amino-9H-purin-9-yl)-5-(((3-aminophenyl)thio)methyl)tetrahydrofuran-3,4-diol (A577286), which is an intermediate used in the synthesis of S-adenosylhomocysteine analogs with biological activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB061222 |
| Pricing | Inquire |
| Cas | 26287-72-9 |
| Molecular Weight | 504.48 |
| Molecular Formula | C28H24O9 |
| Canonical SMILES | CC(=O)OC1C(C(C(O1)COC(=O)C2=CC=CC=C2)OC(=O)C3=CC=CC=C3)OC(=O)C4=CC=CC=C4 |