A-893
A-893 is an inhibitor of SMYD2, which is a lysine methyltransferase. The co-crystal structure reveals the origin of enhanced potency, and effective inhibition of p53K370 methylation in a lung carcinoma (A549) cell line.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1868232-32-9 |
| Pricing | Inquire |
| Cas | 1868232-32-9 |
| Molecular Weight | 577.54 |
| Molecular Formula | C29H38Cl2N4O4 |
| Canonical SMILES | C1CCC(CC1)N(CCNCC(C2=C3C(=CC=C2)NC(=O)CO3)O)C(=O)CCNCCC4=CC(=C(C=C4)Cl)Cl |