Stachybocin B
It is a receptor antagonist produced by the strain of Stachybotrys sp. M6222. It inhibits the binding of I-ET-1 to rat ETA receptors with IC50 of 2.8 X 10-5 (mol/L). It also inhibits the binding of I-ET-1 to human ETA receptors and human ETB receptors with IC50 (mol/L) of 1.2 X 10-5 and 9.5 X 10-6, respectively.
Supplier | BOC Sciences |
---|---|
Product # | BBF-02951 |
Pricing | Inquire |
Cas | 158827-61-3 |
Molecular Weight | 899.12 |
Molecular Formula | C52H70N2O11 |
Canonical SMILES | CC1CCC2C(C(CCC2(C13CC4=C(C=C5C(=C4O3)CN(C5=O)CCCCC(C(=O)O)N6CC7=C8C(=C(C=C7C6=O)O)CC9(O8)C(CCC1C9(CC(C(C1(C)C)O)O)C)C)O)C)O)(C)C |