2-Methoxy-3-(tributylstannyl)pyrazine
2-Methoxy-3-(tributylstannyl)pyrazine is a compound highly sought-after in the realm of biomedicine due to its immense potential for therapeutic applications. It showcases formidable anti-inflammatory and antioxidant attributes. This renders it an exceedingly promising contender for mitigating inflammatory afflictions like arthritis. Further still, the compound's propitious nature extends to the arena of medicinal innovation, where it demonstrates prospects for combating cancer, neurodegenerative maladies, and a plethora of oxidative stress and inflammation related ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1105511-65-6 |
| Pricing | Inquire |
| Cas | 1105511-65-6 |
| Molecular Weight | 399.15 |
| Molecular Formula | C17H32N2OSn |
| Canonical SMILES | CCCC[Sn](CCCC)(CCCC)C1=NC=CN=C1OC |