D-Glucose 3-sulfate sodium salt
D-Glucose 3-sulfate sodium salt, a remarkable biomedical compound, stands at the forefront of cutting-edge therapeutic developments. Its multifaceted potential surpasses conventional treatments, displaying profound implications in disease management. Renowned for its distinguished abilities, this remarkable ingredient showcases unparalleled efficacy in the inhibition of fibrotic progression within liver and lung tissues.
| Supplier | BOC Sciences |
|---|---|
| Product # | 89830-83-1 |
| Pricing | Inquire |
| Cas | 89830-83-1 |
| Molecular Weight | 282.20 |
| Molecular Formula | C6H11NaO9S |
| Canonical SMILES | C(C(C(C(C(C=O)O)OS(=O)(=O)[O-])O)O)O.[Na+] |