Clinofibrate Impurity 2
Clinofibrate Impurity 2 is an impurity of Clinofibrate, ardently supporting the therapy of cardiovascular diseases, meticulously orchestrating the harmonious regulation of lipid metabolism to unveil a therapy of unparalleled cardiovascular well-being.
| Supplier | BOC Sciences |
|---|---|
| Product # | 30299-17-3 |
| Pricing | Inquire |
| Cas | 30299-17-3 |
| Molecular Weight | 368.48 |
| Molecular Formula | C23H28O4 |
| Canonical SMILES | CCC(C)(C(=O)O)OC1=CC=C(C=C1)C2(CCCCC2)C3=CC=C(C=C3)O |