4-O-(2-Acetamido-2-deoxy-a-D-glucopyranosyl)-D-galactopyranose
4-O-(2-Acetamido-2-deoxy-a-D-glucopyranosyl)-D-galactopyranose, commonly known as AGDGP, is an indispensable compound extensively utilized in the biomedical field. Renowned for its indispensable role, this compound serves as a pivotal catalyst in the groundbreaking discovery and formulation of drugs and therapies to combat a myriad of diseases. Notably, AGDGP showcases tremendous potential in treating bacterial infections while simultaneously facilitating the synthesis of glycoproteins for cutting-edge immunotherapy applications.
| Supplier | BOC Sciences |
|---|---|
| Product # | 76909-76-7 |
| Pricing | Inquire |
| Cas | 76909-76-7 |
| Molecular Weight | 383.35 |
| Molecular Formula | C14H25NO11 |
| Canonical SMILES | CC(=O)NC1C(C(C(OC1OC2C(OC(C(C2O)O)O)CO)CO)O)O |